CAS 39773-76-7 appears in our catalog under these names: 2-(Cyclopentyloxy)-2-phenylacetic acid, sodium salt, 98%, 2-(Cyclopentyloxy)-2-phenylacetic acid, sodium salt. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
Sodium 2-cyclopentyloxy-2-phenylacetate (CAS 39773-76-7) is a chemical compound with the molecular formula C13H15NaO3 and a molecular weight of 242.25 g/mol. IUPAC name: sodium 2-cyclopentyloxy-2-phenylacetate. InChIKey: KOUDKNMFBIZXFV-UHFFFAOYSA-M.
| Molecular formula | C13H15NaO3 |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | sodium 2-cyclopentyloxy-2-phenylacetate |
| InChIKey | KOUDKNMFBIZXFV-UHFFFAOYSA-M |
| SMILES | C1CCC(C1)OC(C2=CC=CC=C2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)