CAS 3982-82-9 is the registry number for 1,1,5,5-Tetraphenyltetramethyltrisiloxane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Dimethyl-bis[[methyl(diphenyl)silyl]oxy]silane (CAS 3982-82-9) is a chemical compound with the molecular formula C28H32O2Si3 and a molecular weight of 484.8 g/mol. IUPAC name: dimethyl-bis[[methyl(diphenyl)silyl]oxy]silane. InChIKey: YFCVAZGXPLMNDG-UHFFFAOYSA-N.
| Molecular formula | C28H32O2Si3 |
|---|---|
| Molecular weight | 484.8 g/mol |
| IUPAC name | dimethyl-bis[[methyl(diphenyl)silyl]oxy]silane |
| InChIKey | YFCVAZGXPLMNDG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2)O[Si](C)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)