Products 39860-94-1

CAS 39860-94-1 is the registry number for Benzydamine N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride (CAS 39860-94-1) is a chemical compound with the molecular formula C19H24ClN3O2 and a molecular weight of 361.9 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride. InChIKey: QOKDKSJKRKBVHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24ClN3O2
Molecular weight361.9 g/mol
IUPAC name3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride
InChIKeyQOKDKSJKRKBVHZ-UHFFFAOYSA-N
SMILESC[N+](C)(CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3)[O-].Cl

Computed by PubChem (NCBI)