CAS 39860-94-1 is the registry number for Benzydamine N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 100mg.
3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride (CAS 39860-94-1) is a chemical compound with the molecular formula C19H24ClN3O2 and a molecular weight of 361.9 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride. InChIKey: QOKDKSJKRKBVHZ-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN3O2 |
|---|---|
| Molecular weight | 361.9 g/mol |
| IUPAC name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide;hydrochloride |
| InChIKey | QOKDKSJKRKBVHZ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3)[O-].Cl |
Computed by PubChem (NCBI)