CAS 39891-01-5 is the registry number for 2,3,5-Trichloro-6-(trifluoromethyl)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,3,5-trichloro-6-(trifluoromethyl)pyridine (CAS 39891-01-5) is a chemical compound with the molecular formula C6HCl3F3N and a molecular weight of 250.4 g/mol. IUPAC name: 2,3,5-trichloro-6-(trifluoromethyl)pyridine. InChIKey: HZSKAVACTPGTRH-UHFFFAOYSA-N.
| Molecular formula | C6HCl3F3N |
|---|---|
| Molecular weight | 250.4 g/mol |
| IUPAC name | 2,3,5-trichloro-6-(trifluoromethyl)pyridine |
| InChIKey | HZSKAVACTPGTRH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)