CAS 39925-11-6 appears in our catalog under these names: Ribavirin Impurity 7, Ribavirin Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate (CAS 39925-11-6) is a chemical compound with the molecular formula C15H19N3O9 and a molecular weight of 385.33 g/mol. IUPAC name: methyl 2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate. InChIKey: HEOMJLCCXYSIGI-HKUMRIAESA-N.
| Molecular formula | C15H19N3O9 |
|---|---|
| Molecular weight | 385.33 g/mol |
| IUPAC name | methyl 2-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxylate |
| InChIKey | HEOMJLCCXYSIGI-HKUMRIAESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C(=NC=N2)C(=O)OC)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)