CAS 39941-73-6 is the registry number for 4,8,12-Trimethyl-3,7,11-tridecatrienoyl Chloride. Offered by: TRC. Available pack sizes: 2,5g.
(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoyl chloride (CAS 39941-73-6) is a chemical compound with the molecular formula C16H25ClO and a molecular weight of 268.82 g/mol. IUPAC name: (3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoyl chloride. InChIKey: ABSXCIBBOUAMNG-YFVJMOTDSA-N.
| Molecular formula | C16H25ClO |
|---|---|
| Molecular weight | 268.82 g/mol |
| IUPAC name | (3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoyl chloride |
| InChIKey | ABSXCIBBOUAMNG-YFVJMOTDSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC(=O)Cl)/C)/C)C |
Computed by PubChem (NCBI)