Products 400-36-2

CAS 400-36-2 appears in our catalog under these names: 4,4,4-Trifluoro-3-oxobutanoic acid 95%, 4,4,4-TRIFLUORO-3-OXOBUTYRIC ACID, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4,4,4-trifluoro-3-oxobutanoic acid (CAS 400-36-2) is a chemical compound with the molecular formula C4H3F3O3 and a molecular weight of 156.06 g/mol. IUPAC name: 4,4,4-trifluoro-3-oxobutanoic acid. InChIKey: LIQBKSIZAXKCPA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3F3O3
Molecular weight156.06 g/mol
IUPAC name4,4,4-trifluoro-3-oxobutanoic acid
InChIKeyLIQBKSIZAXKCPA-UHFFFAOYSA-N
SMILESC(C(=O)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)