CAS 400-91-9 is the registry number for 1-Bromo-5-fluoro-2,4-dinitrobenzene, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-bromo-5-fluoro-2,4-dinitrobenzene (CAS 400-91-9) is a chemical compound with the molecular formula C6H2BrFN2O4 and a molecular weight of 264.99 g/mol. IUPAC name: 1-bromo-5-fluoro-2,4-dinitrobenzene. InChIKey: DLNYTDLCDYDPLV-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFN2O4 |
|---|---|
| Molecular weight | 264.99 g/mol |
| IUPAC name | 1-bromo-5-fluoro-2,4-dinitrobenzene |
| InChIKey | DLNYTDLCDYDPLV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)