CAS 400063-10-7 appears in our catalog under these names: Milrinone Impurity B, 2-(Dihydroxymethyl)-6-oxo-1,4,5,6-tetrahydro-(3,4'-bipyridine)-5-carbonitrile Hydrochloride Hydrate, >95% (HPLC), Milrinone Impurity 2 HCl, Milrinone Impurity 15. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg.
6-formyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile (CAS 400063-10-7) is a chemical compound with the molecular formula C12H7N3O2 and a molecular weight of 225.20 g/mol. IUPAC name: 6-formyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile. InChIKey: HTXLYSCLFULIJI-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O2 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 6-formyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile |
| InChIKey | HTXLYSCLFULIJI-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=C(NC(=O)C(=C2)C#N)C=O |
Computed by PubChem (NCBI)