CAS 400078-01-5 is the registry number for 5-Chloro-8-(4-fluoro-2-nitrophenoxy)quinoline. Offered by: Biosynth. Available pack sizes: 100mg.
5-chloro-8-(4-fluoro-2-nitrophenoxy)quinoline (CAS 400078-01-5) is a chemical compound with the molecular formula C15H8ClFN2O3 and a molecular weight of 318.68 g/mol. IUPAC name: 5-chloro-8-(4-fluoro-2-nitrophenoxy)quinoline. InChIKey: OLTOOGBUCYDVNN-UHFFFAOYSA-N.
| Molecular formula | C15H8ClFN2O3 |
|---|---|
| Molecular weight | 318.68 g/mol |
| IUPAC name | 5-chloro-8-(4-fluoro-2-nitrophenoxy)quinoline |
| InChIKey | OLTOOGBUCYDVNN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)OC3=C(C=C(C=C3)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)