CAS 400081-03-0 is the registry number for 1,3-Bis((4-bromophenyl)sulfanyl)propan-2-one. Offered by: Biosynth. Available pack sizes: 500mg.
1,3-bis[(4-bromophenyl)sulfanyl]propan-2-one (CAS 400081-03-0) is a chemical compound with the molecular formula C15H12Br2OS2 and a molecular weight of 432.2 g/mol. IUPAC name: 1,3-bis[(4-bromophenyl)sulfanyl]propan-2-one. InChIKey: BRCVEGOHZULOPS-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2OS2 |
|---|---|
| Molecular weight | 432.2 g/mol |
| IUPAC name | 1,3-bis[(4-bromophenyl)sulfanyl]propan-2-one |
| InChIKey | BRCVEGOHZULOPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SCC(=O)CSC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)