CAS 40051-30-7 appears in our catalog under these names: Phenothiazine Impurity 3, 10-(3-Chloropropyl)-2-(methylsulfonyl)-10H-phenothiazine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
10-(3-chloropropyl)-2-methylsulfonylphenothiazine (CAS 40051-30-7) is a chemical compound with the molecular formula C16H16ClNO2S2 and a molecular weight of 353.9 g/mol. IUPAC name: 10-(3-chloropropyl)-2-methylsulfonylphenothiazine. InChIKey: QQAJFUSAULHWQR-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO2S2 |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | 10-(3-chloropropyl)-2-methylsulfonylphenothiazine |
| InChIKey | QQAJFUSAULHWQR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCCl |
Computed by PubChem (NCBI)