CAS 400771-48-4 appears in our catalog under these names: Z-L-P-Fluoro-phe-chloromethylketone, 95%, Z-p-fluoro-Phe-chloromethylketone. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 1g, 250mg, 5g.
Benzyl N-[(2S)-4-chloro-1-(4-fluorophenyl)-3-oxobutan-2-yl]carbamate (CAS 400771-48-4) is a chemical compound with the molecular formula C18H17ClFNO3 and a molecular weight of 349.8 g/mol. IUPAC name: benzyl N-[(2S)-4-chloro-1-(4-fluorophenyl)-3-oxobutan-2-yl]carbamate. InChIKey: SSXSAFSLNOWRIX-INIZCTEOSA-N.
| Molecular formula | C18H17ClFNO3 |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | benzyl N-[(2S)-4-chloro-1-(4-fluorophenyl)-3-oxobutan-2-yl]carbamate |
| InChIKey | SSXSAFSLNOWRIX-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)F)C(=O)CCl |
Computed by PubChem (NCBI)