CAS 400865-61-4 is the registry number for 2–P–Anisyl–2–propanol–d6. Offered by: GLPBio. Available pack sizes: 100mg.
1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol (CAS 400865-61-4) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 172.25 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol. InChIKey: BFXOWZOXTDBCHP-WFGJKAKNSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 172.25 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol |
| InChIKey | BFXOWZOXTDBCHP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)OC)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)