CAS 400876-70-2 is the registry number for ([3,5-Dimethyl-1-(3-methylphenyl)-1h-pyrazol-4-yl]methyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
[3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methanamine (CAS 400876-70-2) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: [3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methanamine. InChIKey: TWPJZJCHCXRZAU-UHFFFAOYSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | [3,5-dimethyl-1-(3-methylphenyl)pyrazol-4-yl]methanamine |
| InChIKey | TWPJZJCHCXRZAU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=C(C(=N2)C)CN)C |
Computed by PubChem (NCBI)