CAS 4009-98-7 appears in our catalog under these names: (Methoxymethyl)Triphenylphosphonium Chloride, 98%, 98%, (Methoxymethyl)triphenylphosphonium chloride, 98+% , (Methoxymethyl)triphenylphosphonium chloride, 98%, (Methoxymethyl)triphenylphosphonium chloride 98%, ((Methoxy)methyl)triphenylphosphonium Chloride, >95% (HPLC). Offered by: Chemat, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 25g, 50g, 100g, 500g, 1kg, 5kg, 10kg, 25kg.
Methoxymethyl(triphenyl)phosphanium (CAS 4009-98-7) is a chemical compound with the molecular formula C20H20OP+ and a molecular weight of 307.3 g/mol. IUPAC name: methoxymethyl(triphenyl)phosphanium. InChIKey: SDMCZCALYDCRBH-UHFFFAOYSA-N.
| Molecular formula | C20H20OP+ |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | methoxymethyl(triphenyl)phosphanium |
| InChIKey | SDMCZCALYDCRBH-UHFFFAOYSA-N |
| SMILES | COC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)