CAS 40114-84-9 appears in our catalog under these names: 9-Oxo-9h-indeno[1,2-b]pyrazine-2,3-dicarbonitrile, 95%, DCAF, HBX, 9-Oxo-9H-Indeno[1,2-B]Pyrazine-2,3-Dicarbonitrile, 98%, 98%, DCAF, 99.65%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 25mg, 50mg, 0,5g, 5g, 25 mg.
9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CAS 40114-84-9) is a chemical compound with the molecular formula C13H4N4O and a molecular weight of 232.20 g/mol. IUPAC name: 9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile. InChIKey: HUWWIHVYVDAXCT-UHFFFAOYSA-N.
| Molecular formula | C13H4N4O |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 9-oxoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| InChIKey | HUWWIHVYVDAXCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC(=C(N=C3C2=O)C#N)C#N |
Computed by PubChem (NCBI)