CAS 40125-50-6 appears in our catalog under these names: 3,6-Dibromoisobenzofuran-1(3h)-one, 95%, 3,6-Dibromophthalide (Technical Grade) , 3,6-Dibromo-1,3-dihydro-2-benzofuran-1-one. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
3,6-dibromo-3H-2-benzofuran-1-one (CAS 40125-50-6) is a chemical compound with the molecular formula C8H4Br2O2 and a molecular weight of 291.92 g/mol. IUPAC name: 3,6-dibromo-3H-2-benzofuran-1-one. InChIKey: CHJNGDOXAZNOPL-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2O2 |
|---|---|
| Molecular weight | 291.92 g/mol |
| IUPAC name | 3,6-dibromo-3H-2-benzofuran-1-one |
| InChIKey | CHJNGDOXAZNOPL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)OC2Br |
Computed by PubChem (NCBI)