CAS 40127-11-5 appears in our catalog under these names: H–Arg–pNA·2HCl, H-L-Arg-pNA*2HCl, H-Arg-pNA·2HCl 98%, L-ARGININE P-NITROANILIDE DIHYDROCHLORID, H-Arg-pNA.2HCl, 98%, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 250mg, 100MG, 100 mg, 250 mg.
(2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrochloride (CAS 40127-11-5) is a chemical compound with the molecular formula C12H20Cl2N6O3 and a molecular weight of 367.23 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrochloride. InChIKey: FBVMDLFQVOFFHS-XRIOVQLTSA-N.
| Molecular formula | C12H20Cl2N6O3 |
|---|---|
| Molecular weight | 367.23 g/mol |
| IUPAC name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;dihydrochloride |
| InChIKey | FBVMDLFQVOFFHS-XRIOVQLTSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)[C@H](CCCN=C(N)N)N)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)