CAS 40127-26-2 appears in our catalog under these names: Ac-arg-pna hydrochloride, 95%, Ac–Arg–pNA · HCl, Ac-Arg-pNA·HCl, (S)-2-Acetamido-5-guanidino-N-(4-nitrophenyl)pentanamide hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 0,05g, 0,025g, 0,1g, 0,25g, 0,5g.
(2S)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride (CAS 40127-26-2) is a chemical compound with the molecular formula C14H21ClN6O4 and a molecular weight of 372.81 g/mol. IUPAC name: (2S)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride. InChIKey: DIZLHGPXAQZDTN-YDALLXLXSA-N.
| Molecular formula | C14H21ClN6O4 |
|---|---|
| Molecular weight | 372.81 g/mol |
| IUPAC name | (2S)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide;hydrochloride |
| InChIKey | DIZLHGPXAQZDTN-YDALLXLXSA-N |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)