Products 40143-79-1

CAS 40143-79-1 is the registry number for Bis(heptadecafluorooctyl)phosphinic Acid. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid (CAS 40143-79-1) is a chemical compound with the molecular formula C16HF34O2P and a molecular weight of 902.10 g/mol. IUPAC name: bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid. InChIKey: BELPOXSOCHBAEX-UHFFFAOYSA-N.

Identity
Molecular formulaC16HF34O2P
Molecular weight902.10 g/mol
IUPAC namebis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid
InChIKeyBELPOXSOCHBAEX-UHFFFAOYSA-N
SMILESC(C(C(C(C(F)(F)P(=O)(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)