CAS 40143-79-1 is the registry number for Bis(heptadecafluorooctyl)phosphinic Acid. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid (CAS 40143-79-1) is a chemical compound with the molecular formula C16HF34O2P and a molecular weight of 902.10 g/mol. IUPAC name: bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid. InChIKey: BELPOXSOCHBAEX-UHFFFAOYSA-N.
| Molecular formula | C16HF34O2P |
|---|---|
| Molecular weight | 902.10 g/mol |
| IUPAC name | bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phosphinic acid |
| InChIKey | BELPOXSOCHBAEX-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)P(=O)(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)