Products 40156-12-5
CAS 40156-12-5 is the registry number for 7-Phenylbicyclo[2.2.1]hepta-2,5-diene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-phenylbicyclo[2.2.1]hepta-2,5-diene (CAS 40156-12-5) is a chemical compound with the molecular formula C13H12 and a molecular weight of 168.23 g/mol. IUPAC name: 7-phenylbicyclo[2.2.1]hepta-2,5-diene. InChIKey: RZXDPIDGWJRVLT-UHFFFAOYSA-N.
| Molecular formula | C13H12 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 7-phenylbicyclo[2.2.1]hepta-2,5-diene |
| InChIKey | RZXDPIDGWJRVLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C3C=CC2C=C3 |
Computed by PubChem (NCBI)