CAS 401590-64-5 is the registry number for 2-((2,4-Dichlorobenzyl)thio)benzo[d]thiazole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-benzothiazole (CAS 401590-64-5) is a chemical compound with the molecular formula C14H9Cl2NS2 and a molecular weight of 326.3 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-benzothiazole. InChIKey: LKBFSNBBNXEKSC-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NS2 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-1,3-benzothiazole |
| InChIKey | LKBFSNBBNXEKSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCC3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)