CAS 40160-35-8 appears in our catalog under these names: Sodium 3-(4-chloro-phenyl)-3-oxo-propen-1-olate, 95%, Sodium 3-(4-chlorophenyl)-3-oxoprop-1-en-1-olate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g.
Sodium (E)-3-(4-chlorophenyl)-3-oxoprop-1-en-1-olate (CAS 40160-35-8) is a chemical compound with the molecular formula C9H6ClNaO2 and a molecular weight of 204.58 g/mol. IUPAC name: sodium (E)-3-(4-chlorophenyl)-3-oxoprop-1-en-1-olate. InChIKey: LYOIELAPKWHZLI-IPZCTEOASA-M.
| Molecular formula | C9H6ClNaO2 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | sodium (E)-3-(4-chlorophenyl)-3-oxoprop-1-en-1-olate |
| InChIKey | LYOIELAPKWHZLI-IPZCTEOASA-M |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/[O-])Cl.[Na+] |
Computed by PubChem (NCBI)