CAS 401793-01-9 is the registry number for 2-Benzyl 1-(tert-butyl) (2S,4R)-4-(4-bromobenzyl)-5-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-bromophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate (CAS 401793-01-9) is a chemical compound with the molecular formula C24H26BrNO5 and a molecular weight of 488.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-bromophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: GCAJRTAQPRGILN-QUCCMNQESA-N.
| Molecular formula | C24H26BrNO5 |
|---|---|
| Molecular weight | 488.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-[(4-bromophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | GCAJRTAQPRGILN-QUCCMNQESA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C[C@H](C1=O)CC2=CC=C(C=C2)Br)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)