Products 401813-16-9
CAS 401813-16-9 appears in our catalog under these names: Reverse abasic phosphoramidite, Reverse abasic phosphoramidite, 98%, Reverse abasic amidite, 98%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100 mg, 500 mg, 250 mg, 100mg, 250mg, 1g, 5g, 10g.
3-[[(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (CAS 401813-16-9) is a chemical compound with the molecular formula C35H45N2O6P and a molecular weight of 620.7 g/mol. IUPAC name: 3-[[(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile. InChIKey: WPNQXLQBMSUHFX-JUWSMZLESA-N.
| Molecular formula | C35H45N2O6P |
|---|---|
| Molecular weight | 620.7 g/mol |
| IUPAC name | 3-[[(2R,3S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]oxolan-2-yl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| InChIKey | WPNQXLQBMSUHFX-JUWSMZLESA-N |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC[C@@H]1[C@H](CCO1)OC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)