Products 401815-65-4
CAS 401815-65-4 is the registry number for GW461484A. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-fluorophenyl)-6-methyl-3-pyridin-4-ylpyrazolo[1,5-a]pyridine (CAS 401815-65-4) is a chemical compound with the molecular formula C19H14FN3 and a molecular weight of 303.3 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-methyl-3-pyridin-4-ylpyrazolo[1,5-a]pyridine. InChIKey: DLJKUEGEDDMTMQ-UHFFFAOYSA-N.
| Molecular formula | C19H14FN3 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-methyl-3-pyridin-4-ylpyrazolo[1,5-a]pyridine |
| InChIKey | DLJKUEGEDDMTMQ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(C(=N2)C3=CC=C(C=C3)F)C4=CC=NC=C4)C=C1 |
Computed by PubChem (NCBI)