CAS 40186-71-8 appears in our catalog under these names: PCB No. 201 10 µg/mL in Isooctane, 2,2',3,3',4,5',6,6'-Octachlorobiphenyl. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10ml, 50mg, 25mg, 100mg.
1,2,3,5-tetrachloro-4-(2,3,5,6-tetrachlorophenyl)benzene (CAS 40186-71-8) is a chemical compound with the molecular formula C12H2Cl8 and a molecular weight of 429.8 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4-(2,3,5,6-tetrachlorophenyl)benzene. InChIKey: LJQOBQLZTUSEJA-UHFFFAOYSA-N.
| Molecular formula | C12H2Cl8 |
|---|---|
| Molecular weight | 429.8 g/mol |
| IUPAC name | 1,2,3,5-tetrachloro-4-(2,3,5,6-tetrachlorophenyl)benzene |
| InChIKey | LJQOBQLZTUSEJA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)