CAS 40189-22-8 appears in our catalog under these names: 1,3,5-Triphenyladamantane, 97%, 1,3,5-Triphenyladamantane, 95%, 95%, 1,3,5-Triphenyladamantane, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 100mg, 250mg, 1g, 5g, 10g.
1,3,5-triphenyladamantane (CAS 40189-22-8) is a chemical compound with the molecular formula C28H28 and a molecular weight of 364.5 g/mol. IUPAC name: 1,3,5-triphenyladamantane. InChIKey: ASFIKOPZZANWSR-UHFFFAOYSA-N.
| Molecular formula | C28H28 |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 1,3,5-triphenyladamantane |
| InChIKey | ASFIKOPZZANWSR-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1(CC(C2)(C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)