CAS 401892-84-0 appears in our catalog under these names: 4-(Pentafluorothio)benzaldehyde, 98%, 4-(Pentafluorothio)benzaldehyde, 4-(Pentafluorosulfanyl)benzaldehyde 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 250mg, 50mg, 0,5g, 10g, 100mg, 1g, 5g.
4-(pentafluoro-lambda6-sulfanyl)benzaldehyde (CAS 401892-84-0) is a chemical compound with the molecular formula C7H5F5OS and a molecular weight of 232.17 g/mol. IUPAC name: 4-(pentafluoro-lambda6-sulfanyl)benzaldehyde. InChIKey: OTOYBKNIUCEPMV-UHFFFAOYSA-N.
| Molecular formula | C7H5F5OS |
|---|---|
| Molecular weight | 232.17 g/mol |
| IUPAC name | 4-(pentafluoro-lambda6-sulfanyl)benzaldehyde |
| InChIKey | OTOYBKNIUCEPMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)