CAS 401900-41-2 appears in our catalog under these names: 4-Desacetamido-4-fluoro Andarine, >95% (HPLC), 4-Desacetamido-4-fluoro Andarine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 2mg, 25mg, 50mg.
(2S)-3-(4-fluorophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (CAS 401900-41-2) is a chemical compound with the molecular formula C17H14F4N2O5 and a molecular weight of 402.30 g/mol. IUPAC name: (2S)-3-(4-fluorophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide. InChIKey: KJMFOTCDISOHDX-INIZCTEOSA-N.
| Molecular formula | C17H14F4N2O5 |
|---|---|
| Molecular weight | 402.30 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenoxy)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | KJMFOTCDISOHDX-INIZCTEOSA-N |
| SMILES | C[C@](COC1=CC=C(C=C1)F)(C(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)O |
Computed by PubChem (NCBI)