CAS 40202-09-3 is the registry number for 1,1-Dichloroethane-d4. Offered by: TRC. Available pack sizes: 25mg.
1,1-dichloro-1,2,2,2-tetradeuterioethane (CAS 40202-09-3) is a chemical compound with the molecular formula C2H4Cl2 and a molecular weight of 102.98 g/mol. IUPAC name: 1,1-dichloro-1,2,2,2-tetradeuterioethane. InChIKey: SCYULBFZEHDVBN-MZCSYVLQSA-N.
| Molecular formula | C2H4Cl2 |
|---|---|
| Molecular weight | 102.98 g/mol |
| IUPAC name | 1,1-dichloro-1,2,2,2-tetradeuterioethane |
| InChIKey | SCYULBFZEHDVBN-MZCSYVLQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(Cl)Cl |
Computed by PubChem (NCBI)