Products 4025-77-8

CAS 4025-77-8 appears in our catalog under these names: Chlorosulfonylacetyl chloride, 95%, 2-chloro-2-hydroxyethene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chlorosulfonylacetyl chloride (CAS 4025-77-8) is a chemical compound with the molecular formula C2H2Cl2O3S and a molecular weight of 177.01 g/mol. IUPAC name: 2-chlorosulfonylacetyl chloride. InChIKey: MCFSNYMQISXQTF-UHFFFAOYSA-N.

Identity
Molecular formulaC2H2Cl2O3S
Molecular weight177.01 g/mol
IUPAC name2-chlorosulfonylacetyl chloride
InChIKeyMCFSNYMQISXQTF-UHFFFAOYSA-N
SMILESC(C(=O)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)