CAS 402600-59-3 is the registry number for 4-(4-nitrobenzyloxy)benzaldehyde thiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
[(E)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]thiourea (CAS 402600-59-3) is a chemical compound with the molecular formula C15H14N4O3S and a molecular weight of 330.4 g/mol. IUPAC name: [(E)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]thiourea. InChIKey: AWEFVHNRALWAIQ-RQZCQDPDSA-N.
| Molecular formula | C15H14N4O3S |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | [(E)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]thiourea |
| InChIKey | AWEFVHNRALWAIQ-RQZCQDPDSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)/C=N/NC(=S)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)