Products 402788-68-5
CAS 402788-68-5 appears in our catalog under these names: 2-Methoxy-4,5-dihydro-1H-imidazole-4,4,5,5-d4, 99 atom % D, min 98% Chemical Purity, 2-Methoxy-4,5-dihydro-1H-imidazole-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
4,4,5,5-tetradeuterio-2-methoxy-1H-imidazole (CAS 402788-68-5) is a chemical compound with the molecular formula C4H8N2O and a molecular weight of 104.14 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-2-methoxy-1H-imidazole. InChIKey: ZJULPBMTEMGRNC-RRVWJQJTSA-N.
| Molecular formula | C4H8N2O |
|---|---|
| Molecular weight | 104.14 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-2-methoxy-1H-imidazole |
| InChIKey | ZJULPBMTEMGRNC-RRVWJQJTSA-N |
| SMILES | [2H]C1(C(N=C(N1)OC)([2H])[2H])[2H] |
Computed by PubChem (NCBI)