CAS 402855-03-2 appears in our catalog under these names: (R)-N4-(3-Chloro-4-fluorophenyl)-7-(tetrahydrofuran-3-yloxy)quinazoline-4,6-diamine, Afatinib impurity 5, 99.85%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 10 mg, 5 mg, 25 mg.
4-N-(3-chloro-4-fluorophenyl)-7-[(3R)-oxolan-3-yl]oxyquinazoline-4,6-diamine (CAS 402855-03-2) is a chemical compound with the molecular formula C18H16ClFN4O2 and a molecular weight of 374.8 g/mol. IUPAC name: 4-N-(3-chloro-4-fluorophenyl)-7-[(3R)-oxolan-3-yl]oxyquinazoline-4,6-diamine. InChIKey: BIQABKFYKJRXII-LLVKDONJSA-N.
| Molecular formula | C18H16ClFN4O2 |
|---|---|
| Molecular weight | 374.8 g/mol |
| IUPAC name | 4-N-(3-chloro-4-fluorophenyl)-7-[(3R)-oxolan-3-yl]oxyquinazoline-4,6-diamine |
| InChIKey | BIQABKFYKJRXII-LLVKDONJSA-N |
| SMILES | C1COC[C@@H]1OC2=C(C=C3C(=C2)N=CN=C3NC4=CC(=C(C=C4)F)Cl)N |
Computed by PubChem (NCBI)