CAS 40297-09-4 appears in our catalog under these names: MDL 12330A Hydrochloride, MDL 12330A hydrochloride, MDL-12,330A, Hydrochloride 1PCX1MG, MDL 12330A (hydrochloride), MDL12330A, 99.82%. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 10mg, 25mg, 5mg, 1MG, 10mM/1mL, 10 mg, 50 mg.
N-(2-phenylcyclopentyl)-1-azacyclotridecen-2-amine;hydrochloride (CAS 40297-09-4) is a chemical compound with the molecular formula C23H37ClN2 and a molecular weight of 377.0 g/mol. IUPAC name: N-(2-phenylcyclopentyl)-1-azacyclotridecen-2-amine;hydrochloride. InChIKey: CKOPQUCSDBVAQG-UHFFFAOYSA-N.
| Molecular formula | C23H37ClN2 |
|---|---|
| Molecular weight | 377.0 g/mol |
| IUPAC name | N-(2-phenylcyclopentyl)-1-azacyclotridecen-2-amine;hydrochloride |
| InChIKey | CKOPQUCSDBVAQG-UHFFFAOYSA-N |
| SMILES | C1CCCCCC(=NCCCCC1)NC2CCCC2C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)