CAS 40298-25-7 is the registry number for N–Me–Phe–OBzl · p–tosylate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Benzyl (2S)-2-(methylamino)-3-phenylpropanoate;4-methylbenzenesulfonic acid (CAS 40298-25-7) is a chemical compound with the molecular formula C24H27NO5S and a molecular weight of 441.5 g/mol. IUPAC name: benzyl (2S)-2-(methylamino)-3-phenylpropanoate;4-methylbenzenesulfonic acid. InChIKey: TUDJZSODAYRPLC-NTISSMGPSA-N.
| Molecular formula | C24H27NO5S |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | benzyl (2S)-2-(methylamino)-3-phenylpropanoate;4-methylbenzenesulfonic acid |
| InChIKey | TUDJZSODAYRPLC-NTISSMGPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN[C@@H](CC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)