CAS 40299-23-8 is the registry number for Z-L-Phenylalanine 4-nitrobenzyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
(4-nitrophenyl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (CAS 40299-23-8) is a chemical compound with the molecular formula C24H22N2O6 and a molecular weight of 434.4 g/mol. IUPAC name: (4-nitrophenyl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: UQMKSJHSHSCQBP-QFIPXVFZSA-N.
| Molecular formula | C24H22N2O6 |
|---|---|
| Molecular weight | 434.4 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | UQMKSJHSHSCQBP-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)