CAS 403-96-3 is the registry number for 1,3-Bis(3-(trifluoromethyl)phenyl)urea, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-bis[3-(trifluoromethyl)phenyl]urea (CAS 403-96-3) is a chemical compound with the molecular formula C15H10F6N2O and a molecular weight of 348.24 g/mol. IUPAC name: 1,3-bis[3-(trifluoromethyl)phenyl]urea. InChIKey: ASUCRFVOBIZQSN-UHFFFAOYSA-N.
| Molecular formula | C15H10F6N2O |
|---|---|
| Molecular weight | 348.24 g/mol |
| IUPAC name | 1,3-bis[3-(trifluoromethyl)phenyl]urea |
| InChIKey | ASUCRFVOBIZQSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)NC2=CC=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)