Products 40307-15-1

CAS 40307-15-1 appears in our catalog under these names: 2,8-Dibromodibenzothiophene 5,5-dioxide, 95%, 2,8–Dibromodibenzothiophene 5,5–Dioxide, 2,8-Dibromodibenzothiophene 5,5-Dioxide, >95.0%(GC), 2,8-Dibromodibenzo[b,d]thiophene 5,5-dioxide 95%, 2,8-Dibromodibenzo[b,d]thiophene 5,5-dioxide, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 200mg, 250mg, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2,8-dibromodibenzothiophene 5,5-dioxide (CAS 40307-15-1) is a chemical compound with the molecular formula C12H6Br2O2S and a molecular weight of 374.05 g/mol. IUPAC name: 2,8-dibromodibenzothiophene 5,5-dioxide. InChIKey: ZFGCKZCEDNBNMV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Br2O2S
Molecular weight374.05 g/mol
IUPAC name2,8-dibromodibenzothiophene 5,5-dioxide
InChIKeyZFGCKZCEDNBNMV-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)C3=C(S2(=O)=O)C=CC(=C3)Br

Computed by PubChem (NCBI)