CAS 40336-86-5 appears in our catalog under these names: 2,5-Dioxo-2,5-dihydrofuran-3-sulfonyl chloride, 95%, 2,5-Dioxo-2,5-dihydrofuran-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,5-dioxofuran-3-sulfonyl chloride (CAS 40336-86-5) is a chemical compound with the molecular formula C4HClO5S and a molecular weight of 196.57 g/mol. IUPAC name: 2,5-dioxofuran-3-sulfonyl chloride. InChIKey: MFAWKMHHCNMGLM-UHFFFAOYSA-N.
| Molecular formula | C4HClO5S |
|---|---|
| Molecular weight | 196.57 g/mol |
| IUPAC name | 2,5-dioxofuran-3-sulfonyl chloride |
| InChIKey | MFAWKMHHCNMGLM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)OC1=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)