Products 40336-86-5

CAS 40336-86-5 appears in our catalog under these names: 2,5-Dioxo-2,5-dihydrofuran-3-sulfonyl chloride, 95%, 2,5-Dioxo-2,5-dihydrofuran-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

2,5-dioxofuran-3-sulfonyl chloride (CAS 40336-86-5) is a chemical compound with the molecular formula C4HClO5S and a molecular weight of 196.57 g/mol. IUPAC name: 2,5-dioxofuran-3-sulfonyl chloride. InChIKey: MFAWKMHHCNMGLM-UHFFFAOYSA-N.

Identity
Molecular formulaC4HClO5S
Molecular weight196.57 g/mol
IUPAC name2,5-dioxofuran-3-sulfonyl chloride
InChIKeyMFAWKMHHCNMGLM-UHFFFAOYSA-N
SMILESC1=C(C(=O)OC1=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)