CAS 403613-26-3 appears in our catalog under these names: 4-{((trimethylsilyl)oxy)methyl}aniline, 95%, 4-{((Trimethylsilyl)oxy)methyl}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(trimethylsilyloxymethyl)aniline (CAS 403613-26-3) is a chemical compound with the molecular formula C10H17NOSi and a molecular weight of 195.33 g/mol. IUPAC name: 4-(trimethylsilyloxymethyl)aniline. InChIKey: UMGGPDOEWATZPM-UHFFFAOYSA-N.
| Molecular formula | C10H17NOSi |
|---|---|
| Molecular weight | 195.33 g/mol |
| IUPAC name | 4-(trimethylsilyloxymethyl)aniline |
| InChIKey | UMGGPDOEWATZPM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)