CAS 403668-98-4 appears in our catalog under these names: Isopropyl 5,6-diaminonicotinate, 98%, 98%, Isopropyl 5,6-diaminonicotinate, 98%. Offered by: Chemat, Chemat Brand, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, on request.
Propan-2-yl 5,6-diaminopyridine-3-carboxylate (CAS 403668-98-4) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: propan-2-yl 5,6-diaminopyridine-3-carboxylate. InChIKey: WKEHGYIFAAPFBP-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | propan-2-yl 5,6-diaminopyridine-3-carboxylate |
| InChIKey | WKEHGYIFAAPFBP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(N=C1)N)N |
Computed by PubChem (NCBI)