CAS 403671-97-6 is the registry number for rac-trans-3-Amino-1-indanol. Offered by: TRC. Available pack sizes: 500mg.
(1R,3R)-3-amino-2,3-dihydro-1H-inden-1-ol (CAS 403671-97-6) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (1R,3R)-3-amino-2,3-dihydro-1H-inden-1-ol. InChIKey: PRVIGUZMXLBANS-RKDXNWHRSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (1R,3R)-3-amino-2,3-dihydro-1H-inden-1-ol |
| InChIKey | PRVIGUZMXLBANS-RKDXNWHRSA-N |
| SMILES | C1[C@H](C2=CC=CC=C2[C@@H]1O)N |
Computed by PubChem (NCBI)