Products 403694-80-4
CAS 403694-80-4 is the registry number for Ser-Ala-Pro. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-1-[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 403694-80-4) is a chemical compound with the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. IUPAC name: (2S)-1-[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: BRKHVZNDAOMAHX-FXQIFTODSA-N.
| Molecular formula | C11H19N3O5 |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BRKHVZNDAOMAHX-FXQIFTODSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)