CAS 40372-03-0 is the registry number for Ribavirin 2,3,5-Tri-O-acetyl. Offered by: TRC. Available pack sizes: 500mg, 50mg.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate (CAS 40372-03-0) is a chemical compound with the molecular formula C14H18N4O8 and a molecular weight of 370.31 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate. InChIKey: XVXXBJKZJDPHAU-ZHSDAYTOSA-N.
| Molecular formula | C14H18N4O8 |
|---|---|
| Molecular weight | 370.31 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-carbamoyl-1,2,4-triazol-1-yl)oxolan-2-yl]methyl acetate |
| InChIKey | XVXXBJKZJDPHAU-ZHSDAYTOSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC(=N2)C(=O)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)