Products 403842-38-6
CAS 403842-38-6 appears in our catalog under these names: HEMADO, HEMADO, 99.0%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 1 mg.
(2R,3R,4S,5R)-2-[2-hex-1-ynyl-6-(methylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 403842-38-6) is a chemical compound with the molecular formula C17H23N5O4 and a molecular weight of 361.4 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[2-hex-1-ynyl-6-(methylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: KOCIMZNSNPOGOP-IWCJZZDYSA-N.
| Molecular formula | C17H23N5O4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[2-hex-1-ynyl-6-(methylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | KOCIMZNSNPOGOP-IWCJZZDYSA-N |
| SMILES | CCCCC#CC1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC |
Computed by PubChem (NCBI)