CAS 403848-04-4 appears in our catalog under these names: Dorzolamide Impurity 17, Desaminosulfonyl N-Acetyl-dorzolamide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide (CAS 403848-04-4) is a chemical compound with the molecular formula C12H17NO3S2 and a molecular weight of 287.4 g/mol. IUPAC name: N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide. InChIKey: PZBSIOMRFDTKLQ-KWQFWETISA-N.
| Molecular formula | C12H17NO3S2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide |
| InChIKey | PZBSIOMRFDTKLQ-KWQFWETISA-N |
| SMILES | CCN([C@H]1C[C@@H](S(=O)(=O)C2=C1C=CS2)C)C(=O)C |
Computed by PubChem (NCBI)