CAS 403848-09-9 appears in our catalog under these names: Dorzolamide Impurity 1, Dorzolamide Impurity 5, Dorzolamide Impurity 4, Dorzolamide Impurity 7, N-Acetyl Dorzolamide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide (CAS 403848-09-9) is a chemical compound with the molecular formula C12H18N2O5S3 and a molecular weight of 366.5 g/mol. IUPAC name: N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide. InChIKey: LJWKHZXOGKJTFU-XVKPBYJWSA-N.
| Molecular formula | C12H18N2O5S3 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | N-ethyl-N-[(4S,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide |
| InChIKey | LJWKHZXOGKJTFU-XVKPBYJWSA-N |
| SMILES | CCN([C@H]1C[C@@H](S(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N)C)C(=O)C |
Computed by PubChem (NCBI)